C20H17BrCl5N3O3 — CID 19330146
N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19330146) has the molecular formula C20H17BrCl5N3O3 and a molecular weight of 604.54 g/mol. Its IUPAC name is N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19330146 |
| Molecular Formula | C20H17BrCl5N3O3 |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 600.89 |
| IUPAC Name | N-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]-5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2ccc(COc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)o2)c(C)c1Br |
| InChI | InChI=1S/C20H17BrCl5N3O3/c1-9-13(21)10(2)29(28-9)7-3-6-27-20(30)12-5-4-11(32-12)8-31-19-17(25)15(23)14(22)16(24)18(19)26/h4-5H,3,6-8H2,1-2H3,(H,27,30) |
| InChIKey | RWBIUHZFIDUSNY-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|