C22H26ClN3O3 — CID 19295449
N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-[(3,5-dimethylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19295449) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-[(3,5-dimethylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-[(3,5-dimethylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19295449 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-5-[(3,5-dimethylphenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)cc(OCc2ccc(C(=O)NCCCn3nc(C)c(Cl)c3C)o2)c1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-14-10-15(2)12-19(11-14)28-13-18-6-7-20(29-18)22(27)24-8-5-9-26-17(4)21(23)16(3)25-26/h6-7,10-12H,5,8-9,13H2,1-4H3,(H,24,27) |
| InChIKey | RWHRBSUDKMFCSE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|