C20H27NO3 — CID 19463237
5-[(3,5-dimethylphenoxy)methyl]-N-hexylfuran-2-carboxamide (PubChem CID 19463237) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenoxy)methyl]-N-hexylfuran-2-carboxamide.
| Compound Name | 5-[(3,5-dimethylphenoxy)methyl]-N-hexylfuran-2-carboxamide |
|---|---|
| PubChem CID | 19463237 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 5-[(3,5-dimethylphenoxy)methyl]-N-hexylfuran-2-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccc(COc2cc(C)cc(C)c2)o1 |
| InChI | InChI=1S/C20H27NO3/c1-4-5-6-7-10-21-20(22)19-9-8-17(24-19)14-23-18-12-15(2)11-16(3)13-18/h8-9,11-13H,4-7,10,14H2,1-3H3,(H,21,22) |
| InChIKey | FOXLSRWUQUAKAT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|