C18H19F4NO3 — CID 19457206
N-hexyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19457206) has the molecular formula C18H19F4NO3 and a molecular weight of 373.35 g/mol. Its IUPAC name is N-hexyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-hexyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19457206 |
| Molecular Formula | C18H19F4NO3 |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-hexyl-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccc(COc2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C18H19F4NO3/c1-2-3-4-5-8-23-18(24)14-7-6-11(26-14)10-25-17-15(21)12(19)9-13(20)16(17)22/h6-7,9H,2-5,8,10H2,1H3,(H,23,24) |
| InChIKey | PILFUGCPMWLVIC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|