C20H15F4NO3 — CID 19457189
N-(2,3-dimethylphenyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19457189) has the molecular formula C20H15F4NO3 and a molecular weight of 393.34 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19457189 |
| Molecular Formula | C20H15F4NO3 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-(2,3-dimethylphenyl)-5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2ccc(COc3c(F)c(F)cc(F)c3F)o2)c1C |
| InChI | InChI=1S/C20H15F4NO3/c1-10-4-3-5-15(11(10)2)25-20(26)16-7-6-12(28-16)9-27-19-17(23)13(21)8-14(22)18(19)24/h3-8H,9H2,1-2H3,(H,25,26) |
| InChIKey | XEPSWSHRGHXWGU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|