C19H13F4NO3 — CID 19453386
5-[(2-methylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide (PubChem CID 19453386) has the molecular formula C19H13F4NO3 and a molecular weight of 379.31 g/mol. Its IUPAC name is 5-[(2-methylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[(2-methylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19453386 |
| Molecular Formula | C19H13F4NO3 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 5-[(2-methylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide |
| SMILES | Cc1ccccc1OCc1ccc(C(=O)Nc2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C19H13F4NO3/c1-10-4-2-3-5-14(10)26-9-11-6-7-15(27-11)19(25)24-18-16(22)12(20)8-13(21)17(18)23/h2-8H,9H2,1H3,(H,24,25) |
| InChIKey | CMDZCAROUYTFCC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|