C22H19F4NO3 — CID 19450727
5-[(4-tert-butylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide (PubChem CID 19450727) has the molecular formula C22H19F4NO3 and a molecular weight of 421.39 g/mol. Its IUPAC name is 5-[(4-tert-butylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-tert-butylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19450727 |
| Molecular Formula | C22H19F4NO3 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 5-[(4-tert-butylphenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)Nc3c(F)c(F)cc(F)c3F)o2)cc1 |
| InChI | InChI=1S/C22H19F4NO3/c1-22(2,3)12-4-6-13(7-5-12)29-11-14-8-9-17(30-14)21(28)27-20-18(25)15(23)10-16(24)19(20)26/h4-10H,11H2,1-3H3,(H,27,28) |
| InChIKey | XGKAQFOCVNCGQO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|