C21H12F7NO5 — CID 19449044
methyl 4-[[5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate (PubChem CID 19449044) has the molecular formula C21H12F7NO5 and a molecular weight of 491.32 g/mol. Its IUPAC name is methyl 4-[[5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 19449044 |
| Molecular Formula | C21H12F7NO5 |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | methyl 4-[[5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2ccc(C(=O)Nc3c(F)c(F)c(C(F)(F)F)c(F)c3F)o2)cc1 |
| InChI | InChI=1S/C21H12F7NO5/c1-32-20(31)9-2-4-10(5-3-9)33-8-11-6-7-12(34-11)19(30)29-18-16(24)14(22)13(21(26,27)28)15(23)17(18)25/h2-7H,8H2,1H3,(H,29,30) |
| InChIKey | CPSJQFGEQAQZPL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|