C20H16ClNO6 — CID 19448963
methyl 4-[[5-[(5-chloro-2-hydroxyphenyl)carbamoyl]furan-2-yl]methoxy]benzoate (PubChem CID 19448963) has the molecular formula C20H16ClNO6 and a molecular weight of 401.80 g/mol. Its IUPAC name is methyl 4-[[5-[(5-chloro-2-hydroxyphenyl)carbamoyl]furan-2-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[5-[(5-chloro-2-hydroxyphenyl)carbamoyl]furan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 19448963 |
| Molecular Formula | C20H16ClNO6 |
| Molecular Weight | 401.80 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | methyl 4-[[5-[(5-chloro-2-hydroxyphenyl)carbamoyl]furan-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2ccc(C(=O)Nc3cc(Cl)ccc3O)o2)cc1 |
| InChI | InChI=1S/C20H16ClNO6/c1-26-20(25)12-2-5-14(6-3-12)27-11-15-7-9-18(28-15)19(24)22-16-10-13(21)4-8-17(16)23/h2-10,23H,11H2,1H3,(H,22,24) |
| InChIKey | LMLUZVWLBUXUNB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|