C22H16ClNO4 — CID 19412834
N-(5-chloro-2-hydroxyphenyl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide (PubChem CID 19412834) has the molecular formula C22H16ClNO4 and a molecular weight of 393.83 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19412834 |
| Molecular Formula | C22H16ClNO4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1ccc(COc2cccc3ccccc23)o1 |
| InChI | InChI=1S/C22H16ClNO4/c23-15-8-10-19(25)18(12-15)24-22(26)21-11-9-16(28-21)13-27-20-7-3-5-14-4-1-2-6-17(14)20/h1-12,25H,13H2,(H,24,26) |
| InChIKey | VNAJHSCHLFJEAJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|