C22H17NO4 — CID 19460984
N-(2-hydroxyphenyl)-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide (PubChem CID 19460984) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19460984 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(2-hydroxyphenyl)-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1ccc(COc2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C22H17NO4/c24-20-8-4-3-7-19(20)23-22(25)21-12-11-18(27-21)14-26-17-10-9-15-5-1-2-6-16(15)13-17/h1-13,24H,14H2,(H,23,25) |
| InChIKey | VXZZEMURZQPTJQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|