C21H19NO4 — CID 19458809
5-(2,3-dihydro-1H-inden-5-yloxymethyl)-N-(2-hydroxyphenyl)furan-2-carboxamide (PubChem CID 19458809) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yloxymethyl)-N-(2-hydroxyphenyl)furan-2-carboxamide.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yloxymethyl)-N-(2-hydroxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19458809 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yloxymethyl)-N-(2-hydroxyphenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1ccc(COc2ccc3c(c2)CCC3)o1 |
| InChI | InChI=1S/C21H19NO4/c23-19-7-2-1-6-18(19)22-21(24)20-11-10-17(26-20)13-25-16-9-8-14-4-3-5-15(14)12-16/h1-2,6-12,23H,3-5,13H2,(H,22,24) |
| InChIKey | WODSKDBIVNIGMK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|