C24H18N2O4 — CID 55800345
N-[3-(cyanomethoxy)phenyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide (PubChem CID 55800345) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[3-(cyanomethoxy)phenyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-[3-(cyanomethoxy)phenyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 55800345 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[3-(cyanomethoxy)phenyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
| SMILES | N#CCOc1cccc(NC(=O)c2ccc(COc3ccc4ccccc4c3)o2)c1 |
| InChI | InChI=1S/C24H18N2O4/c25-12-13-28-20-7-3-6-19(15-20)26-24(27)23-11-10-22(30-23)16-29-21-9-8-17-4-1-2-5-18(17)14-21/h1-11,14-15H,13,16H2,(H,26,27) |
| InChIKey | QFJOMIVXNLMAEM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |