C23H17F2NO5S — CID 31523225
N-[4-(difluoromethylsulfonyl)phenyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide (PubChem CID 31523225) has the molecular formula C23H17F2NO5S and a molecular weight of 457.45 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 31523225 |
| Molecular Formula | C23H17F2NO5S |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(F)F)cc1)c1ccc(COc2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C23H17F2NO5S/c24-23(25)32(28,29)20-10-6-17(7-11-20)26-22(27)21-12-9-19(31-21)14-30-18-8-5-15-3-1-2-4-16(15)13-18/h1-13,23H,14H2,(H,26,27) |
| InChIKey | PGHULUJSIVMEHV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |