C24H22N2O5S — CID 55345719
5-(naphthalen-2-yloxymethyl)-N-[2-(4-sulfamoylphenyl)ethyl]furan-2-carboxamide (PubChem CID 55345719) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is 5-(naphthalen-2-yloxymethyl)-N-[2-(4-sulfamoylphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-(naphthalen-2-yloxymethyl)-N-[2-(4-sulfamoylphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55345719 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 5-(naphthalen-2-yloxymethyl)-N-[2-(4-sulfamoylphenyl)ethyl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(COc3ccc4ccccc4c3)o2)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c25-32(28,29)22-10-5-17(6-11-22)13-14-26-24(27)23-12-9-21(31-23)16-30-20-8-7-18-3-1-2-4-19(18)15-20/h1-12,15H,13-14,16H2,(H,26,27)(H2,25,28,29) |
| InChIKey | ZAABBJOTWUKKAU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |