C24H18FNO3 — CID 19413095
5-[(4-fluorophenoxy)methyl]-N-(4-phenylphenyl)furan-2-carboxamide (PubChem CID 19413095) has the molecular formula C24H18FNO3 and a molecular weight of 387.41 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-(4-phenylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-(4-phenylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19413095 |
| Molecular Formula | C24H18FNO3 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-(4-phenylphenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C24H18FNO3/c25-19-8-12-21(13-9-19)28-16-22-14-15-23(29-22)24(27)26-20-10-6-18(7-11-20)17-4-2-1-3-5-17/h1-15H,16H2,(H,26,27) |
| InChIKey | CEKYCSQEBFJGSU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |