C26H23NO3 — CID 19463303
5-[(3,5-dimethylphenoxy)methyl]-N-(4-phenylphenyl)furan-2-carboxamide (PubChem CID 19463303) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenoxy)methyl]-N-(4-phenylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(3,5-dimethylphenoxy)methyl]-N-(4-phenylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463303 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 5-[(3,5-dimethylphenoxy)methyl]-N-(4-phenylphenyl)furan-2-carboxamide |
| SMILES | Cc1cc(C)cc(OCc2ccc(C(=O)Nc3ccc(-c4ccccc4)cc3)o2)c1 |
| InChI | InChI=1S/C26H23NO3/c1-18-14-19(2)16-24(15-18)29-17-23-12-13-25(30-23)26(28)27-22-10-8-21(9-11-22)20-6-4-3-5-7-20/h3-16H,17H2,1-2H3,(H,27,28) |
| InChIKey | BWRRQBKIFMDEFT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |