C19H17NO3 — CID 7454734
5-[(4-methylphenoxy)methyl]-N-phenylfuran-2-carboxamide (PubChem CID 7454734) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-[(4-methylphenoxy)methyl]-N-phenylfuran-2-carboxamide.
| Compound Name | 5-[(4-methylphenoxy)methyl]-N-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 7454734 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 5-[(4-methylphenoxy)methyl]-N-phenylfuran-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)Nc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-14-7-9-16(10-8-14)22-13-17-11-12-18(23-17)19(21)20-15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,20,21) |
| InChIKey | LCUSWEAYDHWALJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |