C22H24N2O5S — CID 36706973
5-[(4-methylphenoxy)methyl]-N-[4-(propan-2-ylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 36706973) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is 5-[(4-methylphenoxy)methyl]-N-[4-(propan-2-ylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-methylphenoxy)methyl]-N-[4-(propan-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 36706973 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 5-[(4-methylphenoxy)methyl]-N-[4-(propan-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)Nc3ccc(S(=O)(=O)NC(C)C)cc3)o2)cc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-15(2)24-30(26,27)20-11-6-17(7-12-20)23-22(25)21-13-10-19(29-21)14-28-18-8-4-16(3)5-9-18/h4-13,15,24H,14H2,1-3H3,(H,23,25) |
| InChIKey | HUYFNJAVIICUKW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |