C22H17ClN4O5S — CID 19413705
5-[(4-chlorophenoxy)methyl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 19413705) has the molecular formula C22H17ClN4O5S and a molecular weight of 484.92 g/mol. Its IUPAC name is 5-[(4-chlorophenoxy)methyl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-chlorophenoxy)methyl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19413705 |
| Molecular Formula | C22H17ClN4O5S |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 5-[(4-chlorophenoxy)methyl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1ccc(COc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C22H17ClN4O5S/c23-15-2-6-17(7-3-15)31-14-18-8-11-20(32-18)21(28)26-16-4-9-19(10-5-16)33(29,30)27-22-24-12-1-13-25-22/h1-13H,14H2,(H,26,28)(H,24,25,27) |
| InChIKey | MPNPOINFLZRLAF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |