C23H19N5O7S — CID 19461593
5-[(3-methyl-4-nitrophenoxy)methyl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 19461593) has the molecular formula C23H19N5O7S and a molecular weight of 509.50 g/mol. Its IUPAC name is 5-[(3-methyl-4-nitrophenoxy)methyl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(3-methyl-4-nitrophenoxy)methyl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461593 |
| Molecular Formula | C23H19N5O7S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 5-[(3-methyl-4-nitrophenoxy)methyl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H19N5O7S/c1-15-13-17(5-9-20(15)28(30)31)34-14-18-6-10-21(35-18)22(29)26-16-3-7-19(8-4-16)36(32,33)27-23-24-11-2-12-25-23/h2-13H,14H2,1H3,(H,26,29)(H,24,25,27) |
| InChIKey | MWZNBFWURBSHKJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|