C18H18N4O5 — CID 19346174
N-(1,3-dimethylpyrazol-4-yl)-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19346174) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19346174 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)Nc3cn(C)nc3C)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N4O5/c1-11-8-13(4-6-16(11)22(24)25)26-10-14-5-7-17(27-14)18(23)19-15-9-21(3)20-12(15)2/h4-9H,10H2,1-3H3,(H,19,23) |
| InChIKey | HUCMGINMWGDASU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|