C19H18N4O7 — CID 19342224
methyl 1-methyl-4-[[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxylate (PubChem CID 19342224) has the molecular formula C19H18N4O7 and a molecular weight of 414.37 g/mol. Its IUPAC name is methyl 1-methyl-4-[[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxylate.
| Compound Name | methyl 1-methyl-4-[[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19342224 |
| Molecular Formula | C19H18N4O7 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | methyl 1-methyl-4-[[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])c(C)c3)o2)cnn1C |
| InChI | InChI=1S/C19H18N4O7/c1-11-8-12(4-6-15(11)23(26)27)29-10-13-5-7-16(30-13)18(24)21-14-9-20-22(2)17(14)19(25)28-3/h4-9H,10H2,1-3H3,(H,21,24) |
| InChIKey | ZPZIGBJEYYOIQS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|