C26H19ClN2O6 — CID 19461569
N-(2-benzoyl-4-chlorophenyl)-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461569) has the molecular formula C26H19ClN2O6 and a molecular weight of 490.90 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461569 |
| Molecular Formula | C26H19ClN2O6 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(C(=O)Nc3ccc(Cl)cc3C(=O)c3ccccc3)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H19ClN2O6/c1-16-13-19(8-11-23(16)29(32)33)34-15-20-9-12-24(35-20)26(31)28-22-10-7-18(27)14-21(22)25(30)17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,28,31) |
| InChIKey | GORIAZKXSKUXOM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|