C26H20ClNO4 — CID 19454982
N-(2-benzoyl-4-chlorophenyl)-5-[(2-methylphenoxy)methyl]furan-2-carboxamide (PubChem CID 19454982) has the molecular formula C26H20ClNO4 and a molecular weight of 445.90 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-5-[(2-methylphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-5-[(2-methylphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19454982 |
| Molecular Formula | C26H20ClNO4 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-5-[(2-methylphenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1OCc1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C26H20ClNO4/c1-17-7-5-6-10-23(17)31-16-20-12-14-24(32-20)26(30)28-22-13-11-19(27)15-21(22)25(29)18-8-3-2-4-9-18/h2-15H,16H2,1H3,(H,28,30) |
| InChIKey | UIPQKQLOGVKVEI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |