C25H20ClN3O3 — CID 19277363
N-(2-benzoyl-4-chlorophenyl)-1-[(2-methylphenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19277363) has the molecular formula C25H20ClN3O3 and a molecular weight of 445.91 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-1-[(2-methylphenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-1-[(2-methylphenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19277363 |
| Molecular Formula | C25H20ClN3O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-1-[(2-methylphenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccccc1OCn1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C25H20ClN3O3/c1-17-7-5-6-10-23(17)32-16-29-14-13-22(28-29)25(31)27-21-12-11-19(26)15-20(21)24(30)18-8-3-2-4-9-18/h2-15H,16H2,1H3,(H,27,31) |
| InChIKey | WBKJPOWFQCBXEB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |