C20H15ClF3NO3 — CID 19457399
5-[(4-chloro-2-methylphenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 19457399) has the molecular formula C20H15ClF3NO3 and a molecular weight of 409.79 g/mol. Its IUPAC name is 5-[(4-chloro-2-methylphenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-2-methylphenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19457399 |
| Molecular Formula | C20H15ClF3NO3 |
| Molecular Weight | 409.79 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 5-[(4-chloro-2-methylphenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1OCc1ccc(C(=O)Nc2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C20H15ClF3NO3/c1-12-10-13(21)6-8-17(12)27-11-14-7-9-18(28-14)19(26)25-16-5-3-2-4-15(16)20(22,23)24/h2-10H,11H2,1H3,(H,25,26) |
| InChIKey | HJKBSXUBILKMAR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |