C23H24ClNO4 — CID 19457465
5-[(4-chloro-2-methylphenoxy)methyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)furan-2-carboxamide (PubChem CID 19457465) has the molecular formula C23H24ClNO4 and a molecular weight of 413.90 g/mol. Its IUPAC name is 5-[(4-chloro-2-methylphenoxy)methyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chloro-2-methylphenoxy)methyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19457465 |
| Molecular Formula | C23H24ClNO4 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 5-[(4-chloro-2-methylphenoxy)methyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)furan-2-carboxamide |
| SMILES | Cc1cc(O)c(C(C)C)cc1NC(=O)c1ccc(COc2ccc(Cl)cc2C)o1 |
| InChI | InChI=1S/C23H24ClNO4/c1-13(2)18-11-19(14(3)10-20(18)26)25-23(27)22-8-6-17(29-22)12-28-21-7-5-16(24)9-15(21)4/h5-11,13,26H,12H2,1-4H3,(H,25,27) |
| InChIKey | XKYDCUREQFNTAF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|