C21H16F3NO5 — CID 19448946
methyl 4-[[5-[[2-(trifluoromethyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate (PubChem CID 19448946) has the molecular formula C21H16F3NO5 and a molecular weight of 419.36 g/mol. Its IUPAC name is methyl 4-[[5-[[2-(trifluoromethyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[5-[[2-(trifluoromethyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 19448946 |
| Molecular Formula | C21H16F3NO5 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | methyl 4-[[5-[[2-(trifluoromethyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2ccc(C(=O)Nc3ccccc3C(F)(F)F)o2)cc1 |
| InChI | InChI=1S/C21H16F3NO5/c1-28-20(27)13-6-8-14(9-7-13)29-12-15-10-11-18(30-15)19(26)25-17-5-3-2-4-16(17)21(22,23)24/h2-11H,12H2,1H3,(H,25,26) |
| InChIKey | QNYPHMNYTBGHEO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |