C22H18F3NO2 — CID 3304613
4-[(4-methylphenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]benzamide (PubChem CID 3304613) has the molecular formula C22H18F3NO2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 4-[(4-methylphenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[(4-methylphenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3304613 |
| Molecular Formula | C22H18F3NO2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-[(4-methylphenoxy)methyl]-N-[2-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)Nc3ccccc3C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H18F3NO2/c1-15-6-12-18(13-7-15)28-14-16-8-10-17(11-9-16)21(27)26-20-5-3-2-4-19(20)22(23,24)25/h2-13H,14H2,1H3,(H,26,27) |
| InChIKey | HZGXLNPRLPECQX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |