C24H22F3NO3 — CID 3450576
3-ethoxy-4-[(4-methylphenyl)methoxy]-N-[2-(trifluoromethyl)phenyl]benzamide (PubChem CID 3450576) has the molecular formula C24H22F3NO3 and a molecular weight of 429.44 g/mol. Its IUPAC name is 3-ethoxy-4-[(4-methylphenyl)methoxy]-N-[2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-ethoxy-4-[(4-methylphenyl)methoxy]-N-[2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3450576 |
| Molecular Formula | C24H22F3NO3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 3-ethoxy-4-[(4-methylphenyl)methoxy]-N-[2-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccccc2C(F)(F)F)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H22F3NO3/c1-3-30-22-14-18(12-13-21(22)31-15-17-10-8-16(2)9-11-17)23(29)28-20-7-5-4-6-19(20)24(25,26)27/h4-14H,3,15H2,1-2H3,(H,28,29) |
| InChIKey | MGGVKDCZBWQBOH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |