C23H22INO3 — CID 3328427
3-ethoxy-N-(3-iodophenyl)-4-[(4-methylphenyl)methoxy]benzamide (PubChem CID 3328427) has the molecular formula C23H22INO3 and a molecular weight of 487.34 g/mol. Its IUPAC name is 3-ethoxy-N-(3-iodophenyl)-4-[(4-methylphenyl)methoxy]benzamide.
| Compound Name | 3-ethoxy-N-(3-iodophenyl)-4-[(4-methylphenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 3328427 |
| Molecular Formula | C23H22INO3 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 3-ethoxy-N-(3-iodophenyl)-4-[(4-methylphenyl)methoxy]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(I)c2)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C23H22INO3/c1-3-27-22-13-18(23(26)25-20-6-4-5-19(24)14-20)11-12-21(22)28-15-17-9-7-16(2)8-10-17/h4-14H,3,15H2,1-2H3,(H,25,26) |
| InChIKey | NKBOMANDNPQNPG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|