C22H21NO4 — CID 126089788
3-ethoxy-N-(3-hydroxyphenyl)-4-phenylmethoxybenzamide (PubChem CID 126089788) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-ethoxy-N-(3-hydroxyphenyl)-4-phenylmethoxybenzamide.
| Compound Name | 3-ethoxy-N-(3-hydroxyphenyl)-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126089788 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-ethoxy-N-(3-hydroxyphenyl)-4-phenylmethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(O)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H21NO4/c1-2-26-21-13-17(22(25)23-18-9-6-10-19(24)14-18)11-12-20(21)27-15-16-7-4-3-5-8-16/h3-14,24H,2,15H2,1H3,(H,23,25) |
| InChIKey | OIILMRWAKRUVPB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |