C18H22N2O3 — CID 16778324
N-[3-(aminomethyl)phenyl]-3,4-diethoxybenzamide (PubChem CID 16778324) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]-3,4-diethoxybenzamide.
| Compound Name | N-[3-(aminomethyl)phenyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 16778324 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cccc(CN)c2)cc1OCC |
| InChI | InChI=1S/C18H22N2O3/c1-3-22-16-9-8-14(11-17(16)23-4-2)18(21)20-15-7-5-6-13(10-15)12-19/h5-11H,3-4,12,19H2,1-2H3,(H,20,21) |
| InChIKey | XKXMSJZECPPJRN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |