C18H21N3O4 — CID 38374458
3-(carbamoylamino)-N-(3,4-diethoxyphenyl)benzamide (PubChem CID 38374458) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-(3,4-diethoxyphenyl)benzamide.
| Compound Name | 3-(carbamoylamino)-N-(3,4-diethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 38374458 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-(carbamoylamino)-N-(3,4-diethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc(NC(N)=O)c2)cc1OCC |
| InChI | InChI=1S/C18H21N3O4/c1-3-24-15-9-8-14(11-16(15)25-4-2)20-17(22)12-6-5-7-13(10-12)21-18(19)23/h5-11H,3-4H2,1-2H3,(H,20,22)(H3,19,21,23) |
| InChIKey | MBKINBQGOJQHHR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |