C26H28N2O6 — CID 24645019
1-N,4-N-bis(4-ethoxy-3-methoxyphenyl)benzene-1,4-dicarboxamide (PubChem CID 24645019) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-N,4-N-bis(4-ethoxy-3-methoxyphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-ethoxy-3-methoxyphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 24645019 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-N,4-N-bis(4-ethoxy-3-methoxyphenyl)benzene-1,4-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(OCC)c(OC)c3)cc2)cc1OC |
| InChI | InChI=1S/C26H28N2O6/c1-5-33-21-13-11-19(15-23(21)31-3)27-25(29)17-7-9-18(10-8-17)26(30)28-20-12-14-22(34-6-2)24(16-20)32-4/h7-16H,5-6H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | PIVSEIRFWHKLOZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |