C19H23NO6 — CID 26698623
4-ethoxy-3-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 26698623) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 4-ethoxy-3-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 26698623 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-ethoxy-3-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H23NO6/c1-6-26-14-8-7-12(9-15(14)22-2)19(21)20-13-10-16(23-3)18(25-5)17(11-13)24-4/h7-11H,6H2,1-5H3,(H,20,21) |
| InChIKey | UHUPNKATOXLIMG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |