C17H17F2NO3S — CID 26908446
N-[4-(difluoromethylsulfanyl)phenyl]-4-ethoxy-3-methoxybenzamide (PubChem CID 26908446) has the molecular formula C17H17F2NO3S and a molecular weight of 353.39 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 26908446 |
| Molecular Formula | C17H17F2NO3S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(SC(F)F)cc2)cc1OC |
| InChI | InChI=1S/C17H17F2NO3S/c1-3-23-14-9-4-11(10-15(14)22-2)16(21)20-12-5-7-13(8-6-12)24-17(18)19/h4-10,17H,3H2,1-2H3,(H,20,21) |
| InChIKey | TWOHQPMIPWMPSO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |