C18H19F2NO4 — CID 2467684
N-[4-(difluoromethoxy)phenyl]-3,4-diethoxybenzamide (PubChem CID 2467684) has the molecular formula C18H19F2NO4 and a molecular weight of 351.35 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-3,4-diethoxybenzamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 2467684 |
| Molecular Formula | C18H19F2NO4 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(OC(F)F)cc2)cc1OCC |
| InChI | InChI=1S/C18H19F2NO4/c1-3-23-15-10-5-12(11-16(15)24-4-2)17(22)21-13-6-8-14(9-7-13)25-18(19)20/h5-11,18H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | MMVCPDPDLBICLL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |