C17H18F2N2O5S — CID 9219582
4-(difluoromethoxy)-3-ethoxy-N-[4-(methylsulfamoyl)phenyl]benzamide (PubChem CID 9219582) has the molecular formula C17H18F2N2O5S and a molecular weight of 400.40 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-ethoxy-N-[4-(methylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-ethoxy-N-[4-(methylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 9219582 |
| Molecular Formula | C17H18F2N2O5S |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-(difluoromethoxy)-3-ethoxy-N-[4-(methylsulfamoyl)phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(S(=O)(=O)NC)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C17H18F2N2O5S/c1-3-25-15-10-11(4-9-14(15)26-17(18)19)16(22)21-12-5-7-13(8-6-12)27(23,24)20-2/h4-10,17,20H,3H2,1-2H3,(H,21,22) |
| InChIKey | CNGNPTJNRLEOQO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |