C22H30N2O6S — CID 2976044
3,4-diethoxy-N-[4-(3-ethoxypropylsulfamoyl)phenyl]benzamide (PubChem CID 2976044) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is 3,4-diethoxy-N-[4-(3-ethoxypropylsulfamoyl)phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[4-(3-ethoxypropylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2976044 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3,4-diethoxy-N-[4-(3-ethoxypropylsulfamoyl)phenyl]benzamide |
| SMILES | CCOCCCNS(=O)(=O)c1ccc(NC(=O)c2ccc(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C22H30N2O6S/c1-4-28-15-7-14-23-31(26,27)19-11-9-18(10-12-19)24-22(25)17-8-13-20(29-5-2)21(16-17)30-6-3/h8-13,16,23H,4-7,14-15H2,1-3H3,(H,24,25) |
| InChIKey | NVCOUXUEGSFIFW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|