C19H22N2O6S — CID 3487995
N-[4-(acetylsulfamoyl)phenyl]-3,4-diethoxybenzamide (PubChem CID 3487995) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-3,4-diethoxybenzamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 3487995 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC(C)=O)cc2)cc1OCC |
| InChI | InChI=1S/C19H22N2O6S/c1-4-26-17-11-6-14(12-18(17)27-5-2)19(23)20-15-7-9-16(10-8-15)28(24,25)21-13(3)22/h6-12H,4-5H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | AGYRIWNABPYOME-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |