C18H18BrN3O5S2 — CID 17074012
N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-3-bromo-4-ethoxybenzamide (PubChem CID 17074012) has the molecular formula C18H18BrN3O5S2 and a molecular weight of 500.40 g/mol. Its IUPAC name is N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-3-bromo-4-ethoxybenzamide.
| Compound Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-3-bromo-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17074012 |
| Molecular Formula | C18H18BrN3O5S2 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 498.99 |
| IUPAC Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-3-bromo-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NC(C)=O)cc2)cc1Br |
| InChI | InChI=1S/C18H18BrN3O5S2/c1-3-27-16-9-4-12(10-15(16)19)17(24)21-18(28)20-13-5-7-14(8-6-13)29(25,26)22-11(2)23/h4-10H,3H2,1-2H3,(H,22,23)(H2,20,21,24,28) |
| InChIKey | JOGBCEUWFYKXFB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|