C20H21BrN2O3S — CID 17097847
3-bromo-4-ethoxy-N-[[4-(2-methylprop-2-enoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17097847) has the molecular formula C20H21BrN2O3S and a molecular weight of 449.37 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[[4-(2-methylprop-2-enoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-N-[[4-(2-methylprop-2-enoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17097847 |
| Molecular Formula | C20H21BrN2O3S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[[4-(2-methylprop-2-enoxy)phenyl]carbamothioyl]benzamide |
| SMILES | C=C(C)COc1ccc(NC(=S)NC(=O)c2ccc(OCC)c(Br)c2)cc1 |
| InChI | InChI=1S/C20H21BrN2O3S/c1-4-25-18-10-5-14(11-17(18)21)19(24)23-20(27)22-15-6-8-16(9-7-15)26-12-13(2)3/h5-11H,2,4,12H2,1,3H3,(H2,22,23,24,27) |
| InChIKey | XLSITXPTWFWALP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|