C19H19BrN2O3S — CID 17097766
3-bromo-4-methoxy-N-[[4-(2-methylprop-2-enoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17097766) has the molecular formula C19H19BrN2O3S and a molecular weight of 435.34 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[[4-(2-methylprop-2-enoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-methoxy-N-[[4-(2-methylprop-2-enoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17097766 |
| Molecular Formula | C19H19BrN2O3S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 3-bromo-4-methoxy-N-[[4-(2-methylprop-2-enoxy)phenyl]carbamothioyl]benzamide |
| SMILES | C=C(C)COc1ccc(NC(=S)NC(=O)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C19H19BrN2O3S/c1-12(2)11-25-15-7-5-14(6-8-15)21-19(26)22-18(23)13-4-9-17(24-3)16(20)10-13/h4-10H,1,11H2,2-3H3,(H2,21,22,23,26) |
| InChIKey | HPEXILQIKOHODK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|