C23H28BrNO3 — CID 17097707
3-bromo-4-hexoxy-N-[4-(2-methylprop-2-enoxy)phenyl]benzamide (PubChem CID 17097707) has the molecular formula C23H28BrNO3 and a molecular weight of 446.39 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-[4-(2-methylprop-2-enoxy)phenyl]benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-[4-(2-methylprop-2-enoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17097707 |
| Molecular Formula | C23H28BrNO3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 3-bromo-4-hexoxy-N-[4-(2-methylprop-2-enoxy)phenyl]benzamide |
| SMILES | C=C(C)COc1ccc(NC(=O)c2ccc(OCCCCCC)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H28BrNO3/c1-4-5-6-7-14-27-22-13-8-18(15-21(22)24)23(26)25-19-9-11-20(12-10-19)28-16-17(2)3/h8-13,15H,2,4-7,14,16H2,1,3H3,(H,25,26) |
| InChIKey | LTOASKOTZOXDOF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|