C25H26BrNO3 — CID 17067024
3-bromo-4-butoxy-N-[4-(2-phenylethoxy)phenyl]benzamide (PubChem CID 17067024) has the molecular formula C25H26BrNO3 and a molecular weight of 468.39 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[4-(2-phenylethoxy)phenyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[4-(2-phenylethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17067024 |
| Molecular Formula | C25H26BrNO3 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 3-bromo-4-butoxy-N-[4-(2-phenylethoxy)phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(OCCc3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C25H26BrNO3/c1-2-3-16-30-24-14-9-20(18-23(24)26)25(28)27-21-10-12-22(13-11-21)29-17-15-19-7-5-4-6-8-19/h4-14,18H,2-3,15-17H2,1H3,(H,27,28) |
| InChIKey | NNXJWXBKPPFSKE-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|