C26H36BrNO3 — CID 4959571
3-bromo-N-(4-heptoxyphenyl)-4-hexoxybenzamide (PubChem CID 4959571) has the molecular formula C26H36BrNO3 and a molecular weight of 490.48 g/mol. Its IUPAC name is 3-bromo-N-(4-heptoxyphenyl)-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-(4-heptoxyphenyl)-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4959571 |
| Molecular Formula | C26H36BrNO3 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 3-bromo-N-(4-heptoxyphenyl)-4-hexoxybenzamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)c2ccc(OCCCCCC)c(Br)c2)cc1 |
| InChI | InChI=1S/C26H36BrNO3/c1-3-5-7-9-11-18-30-23-15-13-22(14-16-23)28-26(29)21-12-17-25(24(27)20-21)31-19-10-8-6-4-2/h12-17,20H,3-11,18-19H2,1-2H3,(H,28,29) |
| InChIKey | PMRJGXQZZVOZMO-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|