C27H37BrN2O3S — CID 4959881
3-bromo-N-[(4-heptoxyphenyl)carbamothioyl]-4-hexoxybenzamide (PubChem CID 4959881) has the molecular formula C27H37BrN2O3S and a molecular weight of 549.58 g/mol. Its IUPAC name is 3-bromo-N-[(4-heptoxyphenyl)carbamothioyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[(4-heptoxyphenyl)carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4959881 |
| Molecular Formula | C27H37BrN2O3S |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 3-bromo-N-[(4-heptoxyphenyl)carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)c2ccc(OCCCCCC)c(Br)c2)cc1 |
| InChI | InChI=1S/C27H37BrN2O3S/c1-3-5-7-9-11-18-32-23-15-13-22(14-16-23)29-27(34)30-26(31)21-12-17-25(24(28)20-21)33-19-10-8-6-4-2/h12-17,20H,3-11,18-19H2,1-2H3,(H2,29,30,31,34) |
| InChIKey | WROSZBHNOOBYIS-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|