C27H38N2O3S — CID 4951656
N-[(4-heptoxyphenyl)carbamothioyl]-4-hexoxybenzamide (PubChem CID 4951656) has the molecular formula C27H38N2O3S and a molecular weight of 470.68 g/mol. Its IUPAC name is N-[(4-heptoxyphenyl)carbamothioyl]-4-hexoxybenzamide.
| Compound Name | N-[(4-heptoxyphenyl)carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4951656 |
| Molecular Formula | C27H38N2O3S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | N-[(4-heptoxyphenyl)carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)c2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C27H38N2O3S/c1-3-5-7-9-11-21-32-25-18-14-23(15-19-25)28-27(33)29-26(30)22-12-16-24(17-13-22)31-20-10-8-6-4-2/h12-19H,3-11,20-21H2,1-2H3,(H2,28,29,30,33) |
| InChIKey | LUQYKJNZJWMIHB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|